(-)-Vesamicol | MedChemExpress (MCE)
(-)-Vesamicol (AH5183) is an inhibitor of acetylcholine transport into synaptic vesicles, with the IC50 of 75 nM[1]. (-)-Vesamicol can be used for release and recycling of synaptic vesicles study[1].
| Trivial name | (-)-Vesamicol |
| Catalog Number | HY-113995 |
| Alternative Name(s) | AH5183 |
| Research Area | Neurological Disease |
| CAS# | 112709-59-8 |
| Purity | ≥98.00% |
| SMILES | O[C@H]1[C@H](N2CCC(C3=CC=CC=C3)CC2)CCCC1 |
| PubChem Chemical Structure ID | 659840 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/minus-vesamicol.html |