Tandospirone Citrate
Tandospirone citrate is a potent and selective 5-HT1A receptor partial agonist (Ki = 27 nM) that displays selectivity over SR-2, SR-1C, α1, α2, D1 and D2 receptors (Ki values ranging from 1300-41000 nM).
| Trivial name | SM-3997 Citrate |
| Catalog Number | CSN17480 |
| Alternative Name(s) | SM-3997 Citrate |
| Research Area | Neurological Disease |
| Molecular Formula | C27H37N5O9 |
| CAS# | 112457-95-1 |
| Purity | ≥99% |
| SMILES | O=C1N(CCCCN2CCN(C3=NC=CC=N3)CC2)C([C@@]4([H])[C@](C5)([H])CC[C@]5([H])[C@@]14[H])=O.O=C(CC(C(O)=O)(O)CC(O)=O)O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/tandospirone-citrate.html |