DMPQ dihydrochloride
PDGFRβ inhibitor Tyrosine Kinase|PDGFR
| Catalog Number | B6642-5 |
| Research Area | Tyrosine Kinase|PDGFR |
| Molecular Formula | C16H14N2O2.2HCl |
| CAS# | 1123491-15-5 |
| Purity | 98% |
| SMILES | COC1=C2C(N=CC(C3=CC=NC=C3)=C2)=CC(OC)=C1.Cl.Cl |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6642 |
