BRL 52537 hydrochloride
BRL-52537 hydrochloride is a potent and highly selective κ-opioid agonist. It has neuroprotective effects in animal studies, and is used for research into potential treatments for stroke and heart attack as well as more general brain research.
| Trivial name | / |
| Catalog Number | CSN25444 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C18H25Cl3N2O |
| CAS# | 112282-24-3 |
| Purity | ≥95% |
| SMILES | ClC1=CC=C(CC(N2C(CN3CCCC3)CCCC2)=O)C=C1Cl.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/brl-52537-hydrochloride.html |