Joro spider toxin 3 | MedChemExpress (MCE)
Joro spider toxin 3 is a GABA agonist. Joro spider
toxin 3 blocks the binding of muscle-stimulating diazepam. Joro spider toxin 3
can be used to study the inactivation mechanism of inhibitory GABA receptor
[1].
| Trivial name | Joro spider toxin 3 |
| Catalog Number | HY-W420452 |
| Alternative Name(s) | JSTX-3; Jorotoxin 3 |
| Research Area | Neurological Disease |
| CAS# | 112163-33-4 |
| Purity | ≥98.00% |
| SMILES | C1=CC(=C(C=C1O)O)CC(=O)N[C@@H](CC(=O)N)C(=O)NCCCCCNC(=O)CCNCCCCNCCCN |
| PubChem Chemical Structure ID | 119582 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/joro-spider-toxin-3.html |