UNA-G(iBu)-CE Phosphoramidite
UNA-G(iBu)-CE Phosphoramidite is a uniquely intricate compound possessing potential applications in the realm of cancer therapeutics. Possessing potent antineoplastic capabilities, it demonstrates high efficacy in the research of obstruction in malignant cellular proliferation.
| Catalog Number | PIPB-0343 |
| Alternative Name(s) | EX-A7174K (2R)-2-(((2R)-1-(Bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)-2-(2-isobutyramido-6-oxo-3H-purin-9(6H)-yl)ethyl benzoate N2-isobutyryl-5'-(4,4'-dimethoxytrityl)-2'-benzoyl-2',3'-seco-guanosine-3'-cyanoethyl Phosphoramidite |
| Research Area | Phosphoramidites Series |
| Molecular Formula | C51H60N7O10P |
| CAS# | 1120329-61-4 |
| SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C(COC(=O)C3=CC=CC=C3)OC(COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)COP(N(C(C)C)C(C)C)OCCC#N |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/una-gibu-ce-phosphoramidite-item-10461.html |