Oleic Acid
Oleic acid (Oleate, 9-Octadecenoic Acid, Elaidoic acid) is a fatty acid that occurs naturally in various animal and vegetable fats and oils. It is used commercially in the preparation of oleates and lotions, and as a pharmaceutical solvent. Oleic acid is an abundant monounsaturated fatty acid. Oleic acid is a Na+/K+ ATPase activator.Oleic Acid can be used to induce animal models of Renal Failure.
| Trivial name | Oleate, 9-Octadecenoic Acid, Elaidoic acid |
| Catalog Number | S4707 |
| Molecular Formula | C23H26N6O4S2 |
| CAS# | 112-80-1 |
| Inchi | InChI=1S/C23H26N6O4S2/c1-14-9-16(27(4)25-14)12-28-20-6-5-18(35(32,33)26-23(3)7-8-23)10-19(20)21(30)29(22(28)31)13-17-11-24-15(2)34-17/h5-6,9-11,26H,7-8,12-13H2,1-4H3 |
| Inchi Key | IFWUBRBMMNTBRZ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)CN2C3=C(C=C(C=C3)S(=O)(=O)NC4(CC4)C)C(=O)N(C2=O)CC5=CN=C(S5)C)C |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/oleic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/oleic-acid-chemical-structure-s4707.gif |