Oleic Acid
Oleic acid is a fatty acid that occurs naturally in various animal and vegetable fats and oils. It is also used as an activator of Na+/K+ ATPase.
| Trivial name | Oleate; 9-Octadecenoic Acid; Elaidoic Acid |
| Catalog Number | CSN13472 |
| Alternative Name(s) | Oleate; 9-Octadecenoic Acid; Elaidoic Acid |
| Research Area | / |
| Molecular Formula | C18H34O2 |
| CAS# | 112-80-1 |
| Purity | ≥99% |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/oleic-acid.html |