N-Des[2-(2-hydroxyethoxy)ethyl] Quetiapine Dihydrochloride
A metabolite of Quetiapine, a Benzothiazepine with mixed serotonin and dopamine receptor antagonistic properties used as an antipsychotic.
| Catalog Number | CS-O-05906 |
| Alternative Name(s) | Quetiapine USP Related Compound B;Quetiapine EP Impurity B;11-Piperazin-1-yl-dibenzo[b,f][1,4]thiazepine Dihydrochloride; CS-O-14160 |
| Research Area | Metabolites |
| Molecular Formula | C17H1Cl2N3S |
| CAS# | 111974-74-4 |
| Purity | >98% |
| SMILES | C1(N2CCNCC2)=NC(C=CC=C3)=C3SC4=CC=CC=C14.Cl.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05906.html |