Quetiapine (ICI-204636) fumarate
Quetiapine Fumarate (ICI-204636) is an atypical antipsychotic used in the treatment of schizophrenia, bipolar I mania, bipolar II depression, bipolar I depression and shows affinity for various neurotransmitter receptors including serotonin, dopamine, histamine, and adrenergic receptors.
| Trivial name | ICI-204636 fumarate |
| Catalog Number | S1763 |
| Molecular Formula | C18H17ClN2O3S |
| CAS# | 111974-72-2 |
| Inchi | InChI=1S/C18H17ClN2O3S/c1-23-14-7-3-11(9-15(14)24-2)4-8-17(22)21-18-20-13-6-5-12(19)10-16(13)25-18/h3,5-7,9-10H,4,8H2,1-2H3,(H,20,21,22) |
| Inchi Key | LXFKEVQQSKQXPR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCC(=O)NC2=NC3=C(S2)C=C(C=C3)Cl)OC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/Quetiapine-fumarate(Seroquel).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Quetiapine-fumarate-Seroquel-chemical-structure-S1763.gif |