Quetiapine
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11729 |
| Alternative Name(s) | 2-[2-[4-(Dibenzo[b,f][1,4]thiazepin-11-yl)-1-piperazinyl]ethoxy]ethanol;CS-T-17034 |
| Research Area | Quetiapine is a dibenzothiazepine antipsychotic commonly used as monotherapy for patients with major depressive disorder and schizophrenia. |
| Molecular Formula | C21H25N3O2S |
| CAS# | 111974-69-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OCCOCCN1CCN(C2=NC(C=CC=C3)=C3SC4=CC=CC=C24)CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11729.html |
| Additional Information | NULL |