L-Arginine HCL
L-Arginine hydrochloride is the nitrogen donor for synthesis of nitric oxide, a potent vasodilator that is deficient during times of sickle cell crisis.
| Catalog Number | PIPB-0781 |
| Alternative Name(s) | L-Arginine hydrochloride Arginine Hydrochloride L-ARGININE HCL L-Arginine monohydrochloride |
| Research Area | Peptide APIs |
| Molecular Formula | C6H15ClN4O2 |
| CAS# | 1119-34-2 |
| SMILES | C(CC(C(=O)O)N)CN=C(N)N.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/l-arginine-hcl-item-12382.html |