Squalene
Squalene (Spinacene, Supraene, trans-Squalene), a naturally occurring substance found in plants, animals and humans, is a component of some adjuvants that is added to vaccines to enhance the immune response.
| Trivial name | Spinacene, Supraene, trans-Squalene |
| Catalog Number | S4862 |
| Molecular Formula | C17H19N5OS |
| CAS# | 111-02-4 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=C(C=NN1)C2=CC3=C(S2)C(=O)NC(=N3)C4CC5CCN4CC5 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/squalene.html |
| Additional Information | https://file.selleck.cn/downloads/struct/squalene-chemical-structure-s4862.gif |