Morpholine D8 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-58970 |
| Alternative Name(s) | Morpholine-2,2,3,3,5,5,6,6-d8 Hydrochloride;Morpholine-2,2,3,3,5,5,6,6-d8 Hydrochloride (1:1) |
| Research Area | Morpholine-d8 Hydrochloride is used as a reactant in the synthesis of Moclobemide-d8 , the labeled analogue of Moclobemide , a reversible monoamine oxidase inhibitor. |
| Molecular Formula | C4H2D8ClNO |
| CAS# | 1107650-56-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C1([2H])C([2H])([2H])OC([2H])([2H])C([2H])([2H])N1.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST58970.html |
| Additional Information | NULL |