Lipoxin A5 | MedChemExpress (MCE)
Lipoxin A5 is an eicosapentaenoic acid derived from pig white blood cells. Lipoxin A5 slowly contracted the guinea pig lung parenchymal strips with a contractile force similar to that of LXA4 and LXB4.2, but LXA5 did not have the vasodilating effect on the aortic smooth muscle shown by LXA4 and LXB4.2[1][2].
| Trivial name | Lipoxin A5 |
| Catalog Number | HY-115381 |
| Research Area | Cardiovascular Disease |
| CAS# | 110657-98-2 |
| Purity | ≥98.0% |
| SMILES | OC(CCC[C@H](O)[C@H](O)/C=C/C=C/C=C\C=C\[C@@H](O)C/C=C\CC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lipoxin-a5.html |