ML-7 hydrochloride
ML-7 Hcl is a cell-permeable, reversible, effective, ATP-competitive, and specific inhibitor of myosin light chain kinase (Ki: 300 nM); also inhibits smooth-muscle myosin light chain kinase, PKA, and PKC.
| Catalog Number | T3050 |
| Alternative Name(s) | ML-7 HCl |
| Research Area | Tyrosine Kinase/Adaptors|||Chromatin/Epigenetic|||Stem Cells|||Cell Cycle/Checkpoint|||Metabolism|||Cytoskeletal Signaling |
| Molecular Formula | C15H18ClIN2O2S |
| CAS# | 110448-33-4 |
| Purity | 99.61% |
| SMILES | C1CNCCN(C1)S(=O)(=O)c1cccc2c1cccc2I.Cl |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/ML-7 hydrochloride |
| Additional Information | https://www.targetmol.com/datasheet/T3050 |
