γ-Oryzanol
γ-Oryzanol is a phytochemical with membrane antioxidant, naturally occurring in crude rice bran oil, can be used to treat hyperlipidemia, disorders of menopause and to increase the muscle mass.
| Trivial name | Gamma-oryzanol |
| Catalog Number | CSN20797 |
| Alternative Name(s) | Gamma-oryzanol |
| Research Area | / |
| Molecular Formula | C40H58O4 |
| CAS# | 11042-64-1 |
| Purity | ≥98% |
| SMILES | C[C@@H]([C@@]1([H])CC[C@]2(C)[C@]1(C)CCC34C2CCC5[C@@]3(CC[C@H](OC(/C=C/C6=CC(OC)=C(O)C=C6)=O)C5(C)C)C4)CC/C=C(C)\C |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/r-oryzanol.html |