Cholestyramine resin
Cholestyramine resin is a strongly basic anion exchange resin which can exchange its chloride anions with anionic bile acids in the gastrointestinal tract and bind them strongly in the resin matrix.
| Trivial name | N/A |
| Catalog Number | S4814 |
| Molecular Formula | C25H16Cl2F6N2O2 |
| CAS# | 11041-12-6 |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=C(C(=C(C=C2)OCC3=CC=C(C=C3)Cl)C4=CC(=C(C=C4)Cl)C(F)(F)F)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/cholestyramine-resin.html |