Meclizine dihydrochloride 10 g
Meclizine is a human pregnane X receptor (hPXR) agonist. It possesses anticholinergic, central nervous system depressant, and local anesthetic effects. Its antiemetic and antivertigo effects are not fully understood, but its central anticholinergic properties are partially responsible.
| Trivial name | Meclizine dihydrochloride 10 g |
| Catalog Number | A11700-10000 |
| Alternative Name(s) | 1-[(4-Chlorophenyl)phenylmethyl]4-[ (3-methylphenyl)methyl]piperazine dihydrochloride |
| Molecular Formula | C25H27Cl2N2.2HCl |
| CAS# | 1104-22-9 |
| SMILES | CC1=CC(=CC=C1)CN2CCN(CC2)C(C3=CC=CC=C3)C4=CC=C(C=C4)Cl.Cl.Cl |
| Size | 10000mg |
| Supplier Page | http://www.adooq.com/meclizine-dihydrochloride.html |
