β-Santalol
β-Santalol is a compound of sandalwood oil showing antiinflammatory property by suppressing of lipopolysaccharide-stimulated cytokine/chemokine production in skin cells and anti-viral effect against influenza viral replication in vitro.
| Trivial name | Santalol |
| Catalog Number | CSN11893 |
| Alternative Name(s) | Santalol |
| Research Area | Cancer |
| Molecular Formula | C15H24O |
| CAS# | 11031-45-1 |
| Purity | ≥98% |
| SMILES | OC/C(C)=C/CC[C@@]1(C)[C@@](C2)([H])CC[C@@]2([H])C1=C |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/b-santalol.html |