Agnuside 20mg
Agnuside is an known iridoid glycoside found in Vitex herbs or plants. Agnuside exhibits estrogen-like activities as it interacts with estrogen receptors (ER-alpha) and estrogen receptor-regulated pregesterone receptors.
| Trivial name | Agnuside 20mg |
| Catalog Number | A12015-20 |
| Alternative Name(s) | N/A |
| Molecular Formula | C22H26O11 |
| CAS# | 11027-63-7 |
| SMILES | C1=CO[C@H]([C@H]2[C@@H]1[C@@H](C=C2COC(=O)C3=CC=C(C=C3)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
| Size | 20mg |
| Supplier Page | http://www.adooq.com/agnuside.html |
