JZL184 10mM * 1mL in DMSO
JZL184 is a potent and selective monoacylglycerol lipase (MAGL) inhibitor. Blocks hydrolysis of the endocannabinoid 2-arachidonyl glycerol (2-AG) in vivo in the mouse brain (IC50 = 8 nM).
Trivial name | JZL184 10mM * 1mL in DMSO |
Catalog Number | A12747-10mM-D |
Alternative Name(s) | 4-[Bis(1,3-benzodioxol-5-yl)hydroxy?methyl]-1-piperidinecarboxylic acid 4-nitrophenyl ester |
Molecular Formula | C27H24N2O9 |
CAS# | 1101854-58-3 |
SMILES | C1CN(CCC1C(C2=CC3=C(C=C2)OCO3)(C4=CC5=C(C=C4)OCO5)O)C(=O)OC6=CC=C(C=C6)[N+](=O)[O-] |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/jzl184.html |