MG-101
MG-101 is a potent inhibitor of cysteine proteases including calpain I (Ki = 190 nM), calpain II (Ki = 220 nM), cathepsin B (Ki = 150 nM), and cathepsin L (Ki = 500 pM).
| Trivial name | Calpain Inhibitor-1; ALLN |
| Catalog Number | CSN10529 |
| Alternative Name(s) | Calpain Inhibitor-1; ALLN |
| Research Area | / |
| Molecular Formula | C20H37N3O4 |
| CAS# | 110044-82-1 |
| Purity | ≥98% |
| SMILES | O=C(N[C@H](C=O)CCCC)[C@@H](NC([C@@H](NC(C)=O)CC(C)C)=O)CC(C)C |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/mg-101.html |