ASP3026 10mM * 1mL in DMSO
ASP3026 is a novel and selective inhibitor for the ALK kinase. ASP3026 potently inhibited ALK kinase activity and was more selective than crizotinib in a Tyr-kinase panel.
| Trivial name | ASP3026 10mM * 1mL in DMSO |
| Catalog Number | A11773-10mM-D |
| Alternative Name(s) | N2-[2-Methoxy-4-[4-(4-methyl-1-piperazinyl)-1-piperidinyl]phenyl]-N4-[2-[(1-methylethyl)sulfonyl]phenyl]-1,3,5-triazine-2,4-diamine |
| Molecular Formula | C29H40N8O3S |
| CAS# | 1097917-15-1 |
| SMILES | CC(C)S(=O)(=O)C1=CC=CC=C1NC2=NC=NC(=N2)NC3=C(C=C(C=C3)N4CCC(CC4)N5CCN(CC5)C)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/asp3026.html |