Tacrolimus Monohydrate
Tacrolimus is a potent immunosuppressive drug often administered to transplant recipient patients and exhibits a variety of adverse cardiovascular effects. Its mechanism of action involves the formation of a high affinity complex (Ki = 0.2 nM) with FK-506 binding protein 12 (FKBP12).
Trivial name | FK 506 Monohydrate; Fujimycin Monohydrate; FR-900506 Monohydrate |
Catalog Number | CSN12789 |
Alternative Name(s) | FK 506 Monohydrate; Fujimycin Monohydrate; FR-900506 Monohydrate |
Research Area | Immunology/Inflammation |
Molecular Formula | C44H71NO13 |
CAS# | 109581-93-3 |
Purity | ≥98% |
SMILES | O=C([C@@](CCCC1)([H])N1C(C([C@@]2(O)[C@H](C)C[C@H](OC)[C@@](O2)([H])[C@@H](OC)C[C@@H](C)C/C(C)=C/[C@H]3CC=C)=O)=O)O[C@H](/C(C)=C/[C@H]4C[C@@H](OC)[C@H](O)CC4)[C@H](C)[C@@H](O)CC3=O.O |
Size | 50mg |
Supplier Page | https://www.csnpharm.com/products/tacrolimus-monohydrate.html |