PF-04449913
Antagonist of smoothened Stem Cell|Smoothened
| Catalog Number | B3283-5 |
| Research Area | Stem Cell|Smoothened |
| Molecular Formula | C21H22N6O |
| CAS# | 1095173-27-5 |
| Purity | 98% |
| SMILES | CN1CCC(CC1C2=NC3=CC=CC=C3N2)NC(=O)NC4=CC=C(C=C4)C#N |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3283 |
