(E/Z)-BIX02188
BIX02188 is a specific MEK5 inhibitor (IC50: 4.3 nM), also inhibits ERK5 catalytic activity (IC50: 810 nM), and does not inhibit closely related kinases MEK1/2, JNK2, and ERK2.
| Catalog Number | T6324 |
| Alternative Name(s) | 334949-59-6 |
| Research Area | MAPK|||Stem Cells |
| Molecular Formula | C25H24N4O2 |
| CAS# | 1094614-84-2 |
| Purity | 99.21% |
| SMILES | CN(C)Cc1cccc(N\C(c2ccccc2)=C2/C(=O)Nc3cc(ccc23)C(N)=O)c1 |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/BIX02188 |
| Additional Information | https://www.targetmol.com/datasheet/T6324 |