B-Raf-inhibitor 1 50mg
B-Raf inhibitor 1 is a potent and selective B-Raf inhibitor with cell IC50s of 0.31 uM and 2 nM for A375 proliferation and A375 p-ERK respectively
| Trivial name | B-Raf-inhibitor 1 50mg |
| Catalog Number | A14122-50 |
| Alternative Name(s) | N1-(4-chlorophenyl)-6-Methyl-N5-[3-(9H-purin-6-yl)-2-pyridinyl]- |
| Molecular Formula | C26H19ClN8 |
| CAS# | 1093100-40-3 |
| SMILES | CC1=C(C2=C(C=C1)C(=NC=C2)NC3=CC=C(C=C3)Cl)NC4=C(C=CC=N4)C5=C6C(=NC=N5)N=CN6 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/b-raf-inhibitor-1.html |