IT1t dihydrochloride
CXCR4 antagonist, potent GPCR/G protein|Chemokine Receptors
| Catalog Number | B5650-100 |
| Research Area | GPCR/G protein|Chemokine Receptors |
| Molecular Formula | C21H34N4S2.2HCl |
| CAS# | 1092776-63-0 |
| Purity | 98% |
| SMILES | CC1(CN2C(CS/C(NC3CCCCC3)=N/C4CCCCC4)=CSC2=N1)C.Cl.Cl |
| Size | 100mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B5650 |
