NVP-BSK805 100mg
NVP-BSK805 is a potent and selective inhibition of polycythemia by the quinoxaline JAK2 inhibitor that potently suppressed recombinant human erythropoietin-induced polycythemia and extramedullary erythropoiesis in mice and rats.
| Trivial name | NVP-BSK805 100mg |
| Catalog Number | A11193-100 |
| Alternative Name(s) | 8-[3,5-Difluoro-4-(4-morpholinylmethyl)phenyl]-2-[1-(4-piperidinyl)-1H-pyrazol-4-yl]quinoxaline |
| Molecular Formula | C27H28F2N6O.2HCl |
| CAS# | 1092499-93-8 |
| SMILES | C1CNCCC1N2C=C(C=N2)C3=NC4=C(C=CC=C4N=C3)C5=CC(=C(C(=C5)F)CN6CCOCC6)F.Cl.Cl |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/nvp-bsk805.html |
