Fenofibric Acid D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06617 |
| Alternative Name(s) | 2-[4-(4-chlorobenzoyl)phenoxy]-2- (D3)methyl(2H3)propanoic acid |
| Research Area | Labeled Fenofibric Acid, intended for use as an internal standard for the quantification of Fenofibric Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C17H9D6ClO4 |
| CAS# | 1092484-69-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC=C(Cl)C=C1)C2=CC=C(OC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C(O)=O)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06617.html |
| Additional Information | NULL |