Dibutyl Sebacate
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-17366 |
| Alternative Name(s) | Decanedtyl Ester;dibutyl decanedioate |
| Research Area | Dibutyl sebacate (DBS) is a dibutyl ester of sebacic acid. Dibutyl sebacate can be used for plastics in use in the food packaging industry, in plastics used for medical devices, and for pharmaceutical applications. Dibutyl sebacate is also used as a desensitizer in Otto fuel II, a torpedo monopropellant. |
| Molecular Formula | C18H34O4 |
| CAS# | 109-43-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(OCCCC)CCCCCCCCC(OCCCC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST17366.html |
| Additional Information | NULL |