PF-04447943 25mg
PF-04447943 is a potent, selective brain penetrant PDE9 inhibitor that increased indicators of hippocampal synaptic plasticity and improved cognitive function in a variety of cognition models in both rats and mice.
| Trivial name | PF-04447943 25mg |
| Catalog Number | A13121-25 |
| Alternative Name(s) | N/A |
| Molecular Formula | C20H25N7O2 |
| CAS# | 1082744-20-4 |
| SMILES | C[C@@H]1CN(C[C@H]1C2=NC(=O)C3=CNN(C3=N2)C4CCOCC4)CC5=NC=CC=N5 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/pf-04447943.html |