Tilmicosin
Tilmicosin is a macrolide antibiotic developed for veterinary use, working by inhibiting protein synthesis in bacteria with IC50 value of 0.36 µM.
| Trivial name | EL 870; LY 177370 |
| Catalog Number | CSN12092 |
| Alternative Name(s) | EL 870; LY 177370 |
| Research Area | Infection |
| Molecular Formula | C46H80N2O13 |
| CAS# | 108050-54-0 |
| Purity | ≥98% |
| SMILES | C[C@@H]([C@@H](CC1=O)O)[C@H]([C@H](C[C@H](C(/C=C/C(C)=C/[C@H](CO[C@H](O[C@H](C)[C@@H](O)[C@H]2OC)[C@@H]2OC)[C@@H](CC)O1)=O)C)CCN(C[C@H](C)C3)C[C@H]3C)O[C@@](O[C@H](C)[C@@H](O)[C@@H]4N(C)C)([H])[C@@H]4O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/tilmicosin.html |