3,4-Dihydroxyhydrocinnamic acid
Dihydrocaffeic acid is a phenolic acid found in Gynura bicolor, reduces phosphorylation of MAPK p38 and prevent UVB-induced skin damage, with antioxidant potential and anti-inflammatory activity.
| Trivial name | 3,4-Dihydroxy-benzenepropanoic acid |
| Catalog Number | CSN24901 |
| Alternative Name(s) | 3,4-Dihydroxy-benzenepropanoic acid |
| Research Area | Cancer |
| Molecular Formula | C9H10O4 |
| CAS# | 1078-61-1 |
| Purity | ≥95% |
| SMILES | O=C(O)CCC1=CC=C(O)C(O)=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/3,4-dihydroxyhydrocinnamic-acid.html |