Eplerenone D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06587 |
| Alternative Name(s) | Eplerenone-d3; Epoxymexrenone-d3; Inspra-d3; (7|A,11|A,17|A)-9,11-Epoxy-17-hydroxy-3-oxopregn-4-ene-7,210083-d3 |
| Research Area | Labeled Eplerenone, intended for use as an internal standard for the quantification of Eplerenone by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H27D3O6 |
| CAS# | 107724-20-9 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](C(C[C@H]1C(OC([2H])([2H])[2H])=O)=CC2=O)(CC2)[C@]34[C@]1([H])[C@@](CC[C@@]5(O6)CCC6=O)([H])[C@]5(C)C[C@H]3O4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06587.html |
| Additional Information | NULL |
