LDC000067
CDK9 inhibitor, novel and highly specific Cell Cycle/Checkpoint|Cyclin-Dependent Kinases
| Catalog Number | B4754-5.1 |
| Research Area | Cell Cycle/Checkpoint|Cyclin-Dependent Kinases |
| Molecular Formula | C18H18N4O3S |
| CAS# | 1073485-20-7 |
| Purity | 98.18% |
| SMILES | COC1=CC=CC=C1C2=CC(NC3=CC=CC(CS(N)(=O)=O)=C3)=NC=N2 |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B4754 |
