Demethylzeylasteral
Demethylzeylasteral, a natural product isolated and purified from the herb of Tripterygium wilfordii Hook.f., has strong immunosuppressive activity, that can be used in the fields of organ transplantation and autoimmune disorders. It increases both activation and inactivation time constants of Ca(2+) currents, and inhibits significantly the sperm acrosome reaction initiated by progesterone.
| Trivial name | ZST93 |
| Catalog Number | CSN15657 |
| Alternative Name(s) | ZST93 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C29H36O6 |
| CAS# | 107316-88-1 |
| Purity | ≥99% |
| SMILES | O=C([C@@]1(CC[C@@]2(CC[C@@]3(C4=CC(C5=C([C@@]4(CC[C@]3([C@@]2(C1)[H])C)C)C=C(C(O)=C5C=O)O)=O)C)C)C)O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/demethylzeylasteral.html |
