MLN2238 10mM * 1mL in DMSO
MLN2238 is a potent reversible and specific ??5 site of the 20S proteasome inhibitor with an IC50 value of 3.4 nM.
Trivial name | MLN2238 10mM * 1mL in DMSO |
Catalog Number | A10600-10mM-D |
Alternative Name(s) | (R)-1-(2-(2,5-dichlorobenzamido)acetamido)-3-methylbutylboronic acid |
Molecular Formula | C14H19BCl2N2O4 |
CAS# | 1072833-77-2 |
SMILES | B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/mln2238.html |