BaENR-IN-1 | MedChemExpress (MCE)
BaENR-IN-1 (Compound 5) is an inhibitor of Enoyl-Acyl Carrier Protein Reductase (ENR) (IC50 = 7.7 μM). BaENR-IN-1 blocks the synthesis of fatty acids essential for bacterial growth by inhibiting the bacterial enzyme ENR. BaENR-IN-1 shows activity against bacteria[1].
| Trivial name | BaENR-IN-1 |
| Catalog Number | HY-160679 |
| Research Area | Infection |
| CAS# | 1071966-17-0 |
| Purity | ≥98.0% |
| SMILES | O=[N+]([O-])C1=CC=CC=C1OC2=C(O)C=C(Cl)C=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/baenr-in-1.html |