Kazusamycin B | MedChemExpress (MCE)
Kazusamycin B is an antibiotic that could be isolated from the fermentation broth of Streptomyces sp. No. 81-484. Kazusamycin B inhibits cell growth and arrests cell cycle at G1 phase. Kazusamycin B can be used in research of cancer[1][2].
| Trivial name | Kazusamycin B |
| Catalog Number | HY-118331 |
| Alternative Name(s) | PD 124895; CL-1957E |
| Research Area | Infection; Cancer |
| CAS# | 107140-30-7 |
| Purity | ≥98.00% |
| SMILES | O=C(/C=C(CC(C(C(C(C(/C=C(/C=C/CC(/C=C(/C=C/C1C(C=CC(O1)=O)C)C)C)C)CO)=O)C)O)C)\C)O |
| PubChem Chemical Structure ID | 5386313 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kazusamycin-b.html |