Ethambutol 2HCl
Ethambutol 2HCl is an antitubercular agent working by inhibiting the transfer of mycolic acids into the cell wall of the tubercle bacillus.
| Trivial name | CL 40881; Emb 2HCl |
| Catalog Number | CSN18683 |
| Alternative Name(s) | CL 40881; Emb 2HCl |
| Research Area | Infection |
| Molecular Formula | C10H26Cl2N2O2 |
| CAS# | 1070-11-7 |
| Purity | ≥98% |
| SMILES | CC[C@H](NCCN[C@@H](CC)CO)CO.[H]Cl.[H]Cl |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/ethambutol-2hcl.html |
