Rufinamide
API Standard
| Catalog Number | CS-O-02240 |
| Alternative Name(s) | 1-(2,6-difluorobenzyl)-1H-1,2,3-triazolenovelon. |
| Research Area | Rufinamide is a triazole derivative and an anticonvulsant medication to treat seizure disorders like Lennox-Gastuat syndrome, a form of childhood epilepsy. Clinical trials suggest its efficacy in the treatment of partial seizures |
| Molecular Formula | C10H8F2N4O |
| CAS# | 106308-44-5 |
| Purity | >98% |
| SMILES | FC1=C(C(F)=CC=C1)CN2C=C(C(N)=O)N=N2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02240.html |