Risperidone
Risperidone is a selective blocker of dopamine D2 receptors and serotonin 5-HT2 receptors that act as an atypical antipsychotic agent.
| Catalog Number | T0351 |
| Alternative Name(s) | Risperidal , R 64 766 |
| Research Area | Membrane transporter/Ion channel|||GPCR/G Protein|||Neuroscience |
| Molecular Formula | C23H27FN4O2 |
| CAS# | 106266-06-2 |
| Purity | 100.00% |
| SMILES | Cc1c(CCN2CCC(CC2)c2noc3c2ccc(F)c3)c(=O)n2CCCCc2n1 |
| Size | 25 mg |
| Supplier Page | https://www.targetmol.com/compound/Risperidone |
| Additional Information | https://www.targetmol.com/datasheet/T0351 |