1V209 (TLR7 agonist T7)
1V209 (T7, TLR7 agonist T7) is an agonist of Toll-like receptor 7 (TLR7) with anti-tumor effects. 1V209 can be used as vaccine adjuvants, enhances antigen specific humoral and cellular immune responses.
| Trivial name | T7 |
| Catalog Number | S0078 |
| Molecular Formula | C16H17N5O5 |
| CAS# | 1062444-54-5 |
| SMILES | COCCOC1=NC(=C2C(=N1)N(C(=O)N2)CC3=CC=C(C=C3)C(=O)O)N |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/1v209-tlr7-agonist-t7.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0078-1v209-tlr7-agonist-t7-chemical-structure.gif |