LDN193189 5mg
LDN193189 is a highly potent small molecule BMP inhibitor that inhibits BMP type I receptors ALK2 (IC50: 5 nM), ALK3 (IC50: 30 nM) and ALK6 (TGF??1/BMP signaling) and subsequent SMAD phosphorylation.
| Trivial name | LDN193189 5mg |
| Catalog Number | A11205-5 |
| Alternative Name(s) | 4-[6-(4-Piperazin-1-yl-phenyl)-pyrazolo[1,5-a]pyrimidin-3-yl]-quinoline hydrochloride |
| Molecular Formula | C25H22N6 |
| CAS# | 1062368-24-4 |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C3=CN4C(=C(C=N4)C5=CC=NC6=CC=CC=C56)N=C3 |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/ldn193189.html |