WYE-354
WYE-354(IC50=5 nM) is an effective, selective and ATP-competitive mTOR inhibitor. It blocks mTORC2/P-AKT(S473) and mTORC1/P-S6K(T389), not P-AKT(T308). The selectivity for mTOR is higher than PI3Kα (>100-fold) and PI3Kγ (>500-fold).
| Catalog Number | T6731 |
| Research Area | Apoptosis|||PI3K/Akt/mTOR signaling|||Autophagy |
| Molecular Formula | C24H29N7O5 |
| CAS# | 1062169-56-5 |
| Purity | 98.31% |
| SMILES | COC(=O)Nc1ccc(cc1)c1nc2c(cnn2C2CCN(CC2)C(=O)OC)c(n1)N1CCOCC1 |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/WYE-354 |
| Additional Information | https://www.targetmol.com/datasheet/T6731 |