WYE-354 10mM * 1mL in DMSO
WYE-354 is a potent cell-permeable inhibitor of mTOR (IC50 = 4.3 nM) which blocks signaling through both mTOR complex 1 (mTORC1) and mTORC2. It is a much weaker inhibitor of PI3K ?? (IC50 = 1026 nM) and other kinases.
| Trivial name | WYE-354 10mM * 1mL in DMSO |
| Catalog Number | A10989-10mM-D |
| Alternative Name(s) | 4-?€?[6-?€?[4-?€?[(methoxycarbonyl)amino]phenyl]-?€?4-?€?(4-?€?morpholinyl)-?€?1H-?€?pyrazolo[3,?€?4-?€?d]pyrimidin-?€?1-?€?yl]-?€?methyl ester-?€?1-?€?piperidinecarboxylic acid |
| Molecular Formula | C24H29N7O5 |
| CAS# | 1062169-56-5 |
| SMILES | COC(=O)NC1=CC=C(C=C1)C2=NC3=C(C=NN3C4CCN(CC4)C(=O)OC)C(=N2)N5CCOCC5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/wye-354.html |
