WAY-600
WAY-600 is a potent, ATP-competitive and selective inhibitor of mTOR with IC50 of 9 nM; blocks mTORC1/P-S6K(T389) and mTORC2/P-AKT(S473) but not P-AKT(T308); selective for mTOR than PI3Kα (>100-fold) and PI3Kγ (>500-fold).
| Trivial name | N/A |
| Catalog Number | S2689 |
| Molecular Formula | C20H18FN5O |
| CAS# | 1062159-35-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=NC(=CC=C1)C2=N[NH]C=C2C3=CC(=C(F)C=C3)C4=C[N](CCO)N=C4 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/way-600.html |
| Additional Information | https://file.selleck.cn/downloads/struct/WAY-600-chemical-structure-s2689.gif |