WAY-600 10mM * 1mL in DMSO
WAY-600 is a single digit nanomolar inhibitor of the mTOR kinases, with significant selectivity for these enzymes over phosphatidylinositol 3-kinase (PI3K) isofoms (>100-fold).
| Trivial name | WAY-600 10mM * 1mL in DMSO |
| Catalog Number | A11188-10mM-D |
| Alternative Name(s) | 6-(1H-Indol-5-yl)-4-(4-morpholinyl)-1-[1-(3-pyridinylmethyl)-4-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine |
| Molecular Formula | C28H30N8O |
| CAS# | 1062159-35-6 |
| SMILES | C1CN(CCC1N2C3=C(C=N2)C(=NC(=N3)C4=CC5=C(C=C4)NC=C5)N6CCOCC6)CC7=CN=CC=C7 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/way-600.html |
